C19H15N3O5S — CID 39836222
(E)-3-[4-[(3-pyrazin-2-yloxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid (PubChem CID 39836222) has the molecular formula C19H15N3O5S and a molecular weight of 397.41 g/mol. Its IUPAC name is (E)-3-[4-[(3-pyrazin-2-yloxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(3-pyrazin-2-yloxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 39836222 |
| Molecular Formula | C19H15N3O5S |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | (E)-3-[4-[(3-pyrazin-2-yloxyphenyl)sulfamoyl]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(S(=O)(=O)Nc2cccc(Oc3cnccn3)c2)cc1 |
| InChI | InChI=1S/C19H15N3O5S/c23-19(24)9-6-14-4-7-17(8-5-14)28(25,26)22-15-2-1-3-16(12-15)27-18-13-20-10-11-21-18/h1-13,22H,(H,23,24)/b9-6+ |
| InChIKey | BRRFYRYKCAWFRK-RMKNXTFCSA-N |
| XLogP | 3.17 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|