C20H17N3O3S — CID 46437368
N-(3-pyrazin-2-yloxyphenyl)-3,4-dihydronaphthalene-2-sulfonamide (PubChem CID 46437368) has the molecular formula C20H17N3O3S and a molecular weight of 379.44 g/mol. Its IUPAC name is N-(3-pyrazin-2-yloxyphenyl)-3,4-dihydronaphthalene-2-sulfonamide.
| Compound Name | N-(3-pyrazin-2-yloxyphenyl)-3,4-dihydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 46437368 |
| Molecular Formula | C20H17N3O3S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(3-pyrazin-2-yloxyphenyl)-3,4-dihydronaphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(Oc2cnccn2)c1)C1=Cc2ccccc2CC1 |
| InChI | InChI=1S/C20H17N3O3S/c24-27(25,19-9-8-15-4-1-2-5-16(15)12-19)23-17-6-3-7-18(13-17)26-20-14-21-10-11-22-20/h1-7,10-14,23H,8-9H2 |
| InChIKey | WOGUKJIWDPDTKK-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |