C20H17N3O7S — CID 31912381
dimethyl 2-[(3-pyrazin-2-yloxyphenyl)sulfamoyl]benzene-1,4-dicarboxylate (PubChem CID 31912381) has the molecular formula C20H17N3O7S and a molecular weight of 443.44 g/mol. Its IUPAC name is dimethyl 2-[(3-pyrazin-2-yloxyphenyl)sulfamoyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(3-pyrazin-2-yloxyphenyl)sulfamoyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 31912381 |
| Molecular Formula | C20H17N3O7S |
| Molecular Weight | 443.44 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | dimethyl 2-[(3-pyrazin-2-yloxyphenyl)sulfamoyl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(S(=O)(=O)Nc2cccc(Oc3cnccn3)c2)c1 |
| InChI | InChI=1S/C20H17N3O7S/c1-28-19(24)13-6-7-16(20(25)29-2)17(10-13)31(26,27)23-14-4-3-5-15(11-14)30-18-12-21-8-9-22-18/h3-12,23H,1-2H3 |
| InChIKey | RSPYGADVBKWIKC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |