C21H18FN3O2 — CID 10428785
(E)-3-(4-fluorophenyl)-N-[(1S)-1-(3-pyrazin-2-yloxyphenyl)ethyl]prop-2-enamide (PubChem CID 10428785) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[(1S)-1-(3-pyrazin-2-yloxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[(1S)-1-(3-pyrazin-2-yloxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 10428785 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[(1S)-1-(3-pyrazin-2-yloxyphenyl)ethyl]prop-2-enamide |
| SMILES | C[C@H](NC(=O)/C=C/c1ccc(F)cc1)c1cccc(Oc2cnccn2)c1 |
| InChI | InChI=1S/C21H18FN3O2/c1-15(25-20(26)10-7-16-5-8-18(22)9-6-16)17-3-2-4-19(13-17)27-21-14-23-11-12-24-21/h2-15H,1H3,(H,25,26)/b10-7+/t15-/m0/s1 |
| InChIKey | BITBEDFWBFIXBW-VSGCLNPGSA-N |
| XLogP | 4.30 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|