C21H17ClFN3O2 — CID 20791745
(E)-3-(2-chloro-4-fluorophenyl)-N-[(1S)-1-(3-pyrazin-2-yloxyphenyl)ethyl]prop-2-enamide (PubChem CID 20791745) has the molecular formula C21H17ClFN3O2 and a molecular weight of 397.84 g/mol. Its IUPAC name is (E)-3-(2-chloro-4-fluorophenyl)-N-[(1S)-1-(3-pyrazin-2-yloxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-4-fluorophenyl)-N-[(1S)-1-(3-pyrazin-2-yloxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 20791745 |
| Molecular Formula | C21H17ClFN3O2 |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (E)-3-(2-chloro-4-fluorophenyl)-N-[(1S)-1-(3-pyrazin-2-yloxyphenyl)ethyl]prop-2-enamide |
| SMILES | C[C@H](NC(=O)/C=C/c1ccc(F)cc1Cl)c1cccc(Oc2cnccn2)c1 |
| InChI | InChI=1S/C21H17ClFN3O2/c1-14(26-20(27)8-6-15-5-7-17(23)12-19(15)22)16-3-2-4-18(11-16)28-21-13-24-9-10-25-21/h2-14H,1H3,(H,26,27)/b8-6+/t14-/m0/s1 |
| InChIKey | VKYRRIBVMVCPTO-OWNNVSBGSA-N |
| XLogP | 4.95 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|