C22H18F2N2O2 — CID 22473269
(E)-3-(2,4-difluorophenyl)-N-[1-(3-pyridin-2-yloxyphenyl)ethyl]prop-2-enamide (PubChem CID 22473269) has the molecular formula C22H18F2N2O2 and a molecular weight of 380.39 g/mol. Its IUPAC name is (E)-3-(2,4-difluorophenyl)-N-[1-(3-pyridin-2-yloxyphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-difluorophenyl)-N-[1-(3-pyridin-2-yloxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 22473269 |
| Molecular Formula | C22H18F2N2O2 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (E)-3-(2,4-difluorophenyl)-N-[1-(3-pyridin-2-yloxyphenyl)ethyl]prop-2-enamide |
| SMILES | CC(NC(=O)/C=C/c1ccc(F)cc1F)c1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C22H18F2N2O2/c1-15(26-21(27)11-9-16-8-10-18(23)14-20(16)24)17-5-4-6-19(13-17)28-22-7-2-3-12-25-22/h2-15H,1H3,(H,26,27)/b11-9+ |
| InChIKey | YNRARLSEOLMGJY-PKNBQFBNSA-N |
| XLogP | 5.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|