C23H20F2N2O2 — CID 10023539
(E)-3-(2,5-difluorophenyl)-N-[(1S)-1-[3-[(6-methyl-3-pyridinyl)oxy]phenyl]ethyl]prop-2-enamide (PubChem CID 10023539) has the molecular formula C23H20F2N2O2 and a molecular weight of 394.42 g/mol. Its IUPAC name is (E)-3-(2,5-difluorophenyl)-N-[(1S)-1-[3-[(6-methyl-3-pyridinyl)oxy]phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-difluorophenyl)-N-[(1S)-1-[3-[(6-methyl-3-pyridinyl)oxy]phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 10023539 |
| Molecular Formula | C23H20F2N2O2 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (E)-3-(2,5-difluorophenyl)-N-[(1S)-1-[3-[(6-methyl-3-pyridinyl)oxy]phenyl]ethyl]prop-2-enamide |
| SMILES | Cc1ccc(Oc2cccc([C@H](C)NC(=O)/C=C/c3cc(F)ccc3F)c2)cn1 |
| InChI | InChI=1S/C23H20F2N2O2/c1-15-6-9-21(14-26-15)29-20-5-3-4-17(13-20)16(2)27-23(28)11-7-18-12-19(24)8-10-22(18)25/h3-14,16H,1-2H3,(H,27,28)/b11-7+/t16-/m0/s1 |
| InChIKey | KRGDYACLMFDLRC-BPLPYTOXSA-N |
| XLogP | 5.35 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|