C15H12N2O5S2 — CID 167966038
3-[[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]methyl]benzoic acid (PubChem CID 167966038) has the molecular formula C15H12N2O5S2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-[[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]methyl]benzoic acid.
| Compound Name | 3-[[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 167966038 |
| Molecular Formula | C15H12N2O5S2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 3-[[(2-oxo-3H-1,3-benzothiazol-6-yl)sulfonylamino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNS(=O)(=O)c2ccc3[nH]c(=O)sc3c2)c1 |
| InChI | InChI=1S/C15H12N2O5S2/c18-14(19)10-3-1-2-9(6-10)8-16-24(21,22)11-4-5-12-13(7-11)23-15(20)17-12/h1-7,16H,8H2,(H,17,20)(H,18,19) |
| InChIKey | BXDSWFAFLXLFCD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |