C17H18N2O5S2 — CID 15998071
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxo-3H-1,3-benzothiazole-6-sulfonamide (PubChem CID 15998071) has the molecular formula C17H18N2O5S2 and a molecular weight of 394.47 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxo-3H-1,3-benzothiazole-6-sulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxo-3H-1,3-benzothiazole-6-sulfonamide |
|---|---|
| PubChem CID | 15998071 |
| Molecular Formula | C17H18N2O5S2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxo-3H-1,3-benzothiazole-6-sulfonamide |
| SMILES | COc1ccc(CCNS(=O)(=O)c2ccc3[nH]c(=O)sc3c2)cc1OC |
| InChI | InChI=1S/C17H18N2O5S2/c1-23-14-6-3-11(9-15(14)24-2)7-8-18-26(21,22)12-4-5-13-16(10-12)25-17(20)19-13/h3-6,9-10,18H,7-8H2,1-2H3,(H,19,20) |
| InChIKey | MQJQLNONNLJDLK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |