C17H19N5O4S — CID 24792691
N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(tetrazol-1-yl)benzenesulfonamide (PubChem CID 24792691) has the molecular formula C17H19N5O4S and a molecular weight of 389.44 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(tetrazol-1-yl)benzenesulfonamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(tetrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 24792691 |
| Molecular Formula | C17H19N5O4S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4-(tetrazol-1-yl)benzenesulfonamide |
| SMILES | COc1ccc(CCNS(=O)(=O)c2ccc(-n3cnnn3)cc2)cc1OC |
| InChI | InChI=1S/C17H19N5O4S/c1-25-16-8-3-13(11-17(16)26-2)9-10-19-27(23,24)15-6-4-14(5-7-15)22-12-18-20-21-22/h3-8,11-12,19H,9-10H2,1-2H3 |
| InChIKey | FMVSNEZPQKFIBA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |