C11H15N5O3S — CID 3212817
3-methoxy-N-propyl-4-(tetrazol-1-yl)benzenesulfonamide (PubChem CID 3212817) has the molecular formula C11H15N5O3S and a molecular weight of 297.34 g/mol. Its IUPAC name is 3-methoxy-N-propyl-4-(tetrazol-1-yl)benzenesulfonamide.
| Compound Name | 3-methoxy-N-propyl-4-(tetrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3212817 |
| Molecular Formula | C11H15N5O3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-methoxy-N-propyl-4-(tetrazol-1-yl)benzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1ccc(-n2cnnn2)c(OC)c1 |
| InChI | InChI=1S/C11H15N5O3S/c1-3-6-13-20(17,18)9-4-5-10(11(7-9)19-2)16-8-12-14-15-16/h4-5,7-8,13H,3,6H2,1-2H3 |
| InChIKey | QZAPNOFJKLQKDQ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |