C14H20N6O4S — CID 16762172
2-[[4-methoxy-3-(tetrazol-1-yl)phenyl]sulfonylamino]-4-methylpentanamide (PubChem CID 16762172) has the molecular formula C14H20N6O4S and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-[[4-methoxy-3-(tetrazol-1-yl)phenyl]sulfonylamino]-4-methylpentanamide.
| Compound Name | 2-[[4-methoxy-3-(tetrazol-1-yl)phenyl]sulfonylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 16762172 |
| Molecular Formula | C14H20N6O4S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[[4-methoxy-3-(tetrazol-1-yl)phenyl]sulfonylamino]-4-methylpentanamide |
| SMILES | COc1ccc(S(=O)(=O)NC(CC(C)C)C(N)=O)cc1-n1cnnn1 |
| InChI | InChI=1S/C14H20N6O4S/c1-9(2)6-11(14(15)21)17-25(22,23)10-4-5-13(24-3)12(7-10)20-8-16-18-19-20/h4-5,7-9,11,17H,6H2,1-3H3,(H2,15,21) |
| InChIKey | XWYPUYIIXLCFPK-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |