C15H12N2O4S2 — CID 166210715
3-[(thieno[3,2-b]pyridin-6-ylsulfonylamino)methyl]benzoic acid (PubChem CID 166210715) has the molecular formula C15H12N2O4S2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 3-[(thieno[3,2-b]pyridin-6-ylsulfonylamino)methyl]benzoic acid.
| Compound Name | 3-[(thieno[3,2-b]pyridin-6-ylsulfonylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 166210715 |
| Molecular Formula | C15H12N2O4S2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 3-[(thieno[3,2-b]pyridin-6-ylsulfonylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNS(=O)(=O)c2cnc3ccsc3c2)c1 |
| InChI | InChI=1S/C15H12N2O4S2/c18-15(19)11-3-1-2-10(6-11)8-17-23(20,21)12-7-14-13(16-9-12)4-5-22-14/h1-7,9,17H,8H2,(H,18,19) |
| InChIKey | IWVLOWIXZVWVGO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |