C22H24F4N2O2S — CID 134312328
N-[2-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]-4-fluorobenzenesulfonamide (PubChem CID 134312328) has the molecular formula C22H24F4N2O2S and a molecular weight of 456.51 g/mol. Its IUPAC name is N-[2-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[2-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 134312328 |
| Molecular Formula | C22H24F4N2O2S |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[2-[(4aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(C(F)(F)F)ccc1N1CC[C@@H]2CCCCC2C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24F4N2O2S/c23-18-6-8-19(9-7-18)31(29,30)27-20-13-17(22(24,25)26)5-10-21(20)28-12-11-15-3-1-2-4-16(15)14-28/h5-10,13,15-16,27H,1-4,11-12,14H2/t15-,16?/m0/s1 |
| InChIKey | KTBPGXWISGQRLY-VYRBHSGPSA-N |
| XLogP | 5.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |