C22H25F3N2O2S — CID 134312264
N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 134312264) has the molecular formula C22H25F3N2O2S and a molecular weight of 438.52 g/mol. Its IUPAC name is N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134312264 |
| Molecular Formula | C22H25F3N2O2S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc(C(F)(F)F)ccc1N1CC[C@@H]2CCCC[C@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C22H25F3N2O2S/c23-22(24,25)18-10-11-21(27-13-12-16-6-4-5-7-17(16)15-27)20(14-18)26-30(28,29)19-8-2-1-3-9-19/h1-3,8-11,14,16-17,26H,4-7,12-13,15H2/t16-,17-/m0/s1 |
| InChIKey | NQQUQADWFIWCFE-IRXDYDNUSA-N |
| XLogP | 5.52 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |