C22H24F3N3S — CID 87200120
N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]pyridine-4-carbothioamide (PubChem CID 87200120) has the molecular formula C22H24F3N3S and a molecular weight of 419.52 g/mol. Its IUPAC name is N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]pyridine-4-carbothioamide.
| Compound Name | N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 87200120 |
| Molecular Formula | C22H24F3N3S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[2-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-5-(trifluoromethyl)phenyl]pyridine-4-carbothioamide |
| SMILES | FC(F)(F)c1ccc(N2CC[C@@H]3CCCC[C@H]3C2)c(NC(=S)c2ccncc2)c1 |
| InChI | InChI=1S/C22H24F3N3S/c23-22(24,25)18-5-6-20(28-12-9-15-3-1-2-4-17(15)14-28)19(13-18)27-21(29)16-7-10-26-11-8-16/h5-8,10-11,13,15,17H,1-4,9,12,14H2,(H,27,29)/t15-,17-/m0/s1 |
| InChIKey | RBXFREXYVLAVCD-RDJZCZTQSA-N |
| XLogP | 5.90 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|