C17H18F3N3 — CID 110453003
N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]pyridin-4-amine (PubChem CID 110453003) has the molecular formula C17H18F3N3 and a molecular weight of 321.35 g/mol. Its IUPAC name is N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]pyridin-4-amine.
| Compound Name | N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 110453003 |
| Molecular Formula | C17H18F3N3 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[2-piperidin-1-yl-5-(trifluoromethyl)phenyl]pyridin-4-amine |
| SMILES | FC(F)(F)c1ccc(N2CCCCC2)c(Nc2ccncc2)c1 |
| InChI | InChI=1S/C17H18F3N3/c18-17(19,20)13-4-5-16(23-10-2-1-3-11-23)15(12-13)22-14-6-8-21-9-7-14/h4-9,12H,1-3,10-11H2,(H,21,22) |
| InChIKey | MLTPWTUGPGADSO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |