C30H41N5O4S — CID 42679055
N-cyclohexyl-4-[4-[(4-methylphenyl)sulfonylamino]-2-(piperidine-1-carbonyl)phenyl]piperazine-1-carboxamide (PubChem CID 42679055) has the molecular formula C30H41N5O4S and a molecular weight of 567.76 g/mol. Its IUPAC name is N-cyclohexyl-4-[4-[(4-methylphenyl)sulfonylamino]-2-(piperidine-1-carbonyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[4-[(4-methylphenyl)sulfonylamino]-2-(piperidine-1-carbonyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42679055 |
| Molecular Formula | C30H41N5O4S |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.29 |
| IUPAC Name | N-cyclohexyl-4-[4-[(4-methylphenyl)sulfonylamino]-2-(piperidine-1-carbonyl)phenyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(N3CCN(C(=O)NC4CCCCC4)CC3)c(C(=O)N3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C30H41N5O4S/c1-23-10-13-26(14-11-23)40(38,39)32-25-12-15-28(27(22-25)29(36)34-16-6-3-7-17-34)33-18-20-35(21-19-33)30(37)31-24-8-4-2-5-9-24/h10-15,22,24,32H,2-9,16-21H2,1H3,(H,31,37) |
| InChIKey | IESJCPHQUVBLDC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|