C19H20ClF3N2O6S2 — CID 146055044
5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-(4-methylpiperidin-1-yl)benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 146055044) has the molecular formula C19H20ClF3N2O6S2 and a molecular weight of 528.96 g/mol. Its IUPAC name is 5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-(4-methylpiperidin-1-yl)benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-(4-methylpiperidin-1-yl)benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146055044 |
| Molecular Formula | C19H20ClF3N2O6S2 |
| Molecular Weight | 528.96 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 5-[(5-chlorothiophen-2-yl)sulfonylamino]-2-(4-methylpiperidin-1-yl)benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC1CCN(c2ccc(NS(=O)(=O)c3ccc(Cl)s3)cc2C(=O)O)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H19ClN2O4S2.C2HF3O2/c1-11-6-8-20(9-7-11)14-3-2-12(10-13(14)17(21)22)19-26(23,24)16-5-4-15(18)25-16;3-2(4,5)1(6)7/h2-5,10-11,19H,6-9H2,1H3,(H,21,22);(H,6,7) |
| InChIKey | LYDOOCUZSLETMR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.96 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|