C14H12N2O5S2 — CID 10959108
N-(3-acetyl-1,2-dihydroxyindol-6-yl)thiophene-2-sulfonamide (PubChem CID 10959108) has the molecular formula C14H12N2O5S2 and a molecular weight of 352.39 g/mol. Its IUPAC name is N-(3-acetyl-1,2-dihydroxyindol-6-yl)thiophene-2-sulfonamide.
| Compound Name | N-(3-acetyl-1,2-dihydroxyindol-6-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 10959108 |
| Molecular Formula | C14H12N2O5S2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | N-(3-acetyl-1,2-dihydroxyindol-6-yl)thiophene-2-sulfonamide |
| SMILES | CC(=O)c1c(O)n(O)c2cc(NS(=O)(=O)c3cccs3)ccc12 |
| InChI | InChI=1S/C14H12N2O5S2/c1-8(17)13-10-5-4-9(7-11(10)16(19)14(13)18)15-23(20,21)12-3-2-6-22-12/h2-7,15,18-19H,1H3 |
| InChIKey | JUAHSUOCCATFEQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|