C25H26ClN5O3 — CID 55792276
4-[[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]carbamoyl]-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 55792276) has the molecular formula C25H26ClN5O3 and a molecular weight of 479.97 g/mol. Its IUPAC name is 4-[[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]carbamoyl]-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 4-[[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]carbamoyl]-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 55792276 |
| Molecular Formula | C25H26ClN5O3 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-[[[2-(2-chlorophenyl)quinoline-4-carbonyl]amino]carbamoyl]-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(C(=O)NNC(=O)c2cc(-c3ccccc3Cl)nc3ccccc23)CC1 |
| InChI | InChI=1S/C25H26ClN5O3/c1-30(2)25(34)31-13-11-16(12-14-31)23(32)28-29-24(33)19-15-22(18-8-3-5-9-20(18)26)27-21-10-6-4-7-17(19)21/h3-10,15-16H,11-14H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | XTQNMDOVQXOWLL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|