C23H21N3O9S — CID 23966770
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4,5-dimethoxy-2-(thiophene-2-carbonylamino)benzoate (PubChem CID 23966770) has the molecular formula C23H21N3O9S and a molecular weight of 515.50 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4,5-dimethoxy-2-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4,5-dimethoxy-2-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 23966770 |
| Molecular Formula | C23H21N3O9S |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 4,5-dimethoxy-2-(thiophene-2-carbonylamino)benzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2cc(OC)c(OC)cc2NC(=O)c2cccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H21N3O9S/c1-32-13-6-7-15(17(9-13)26(30)31)24-21(27)12-35-23(29)14-10-18(33-2)19(34-3)11-16(14)25-22(28)20-5-4-8-36-20/h4-11H,12H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | GZTMYKNJOXSILT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|