C30H22N2O8S — CID 4299184
[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 4,5-dimethoxy-2-(thiophene-2-carbonylamino)benzoate (PubChem CID 4299184) has the molecular formula C30H22N2O8S and a molecular weight of 570.58 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 4,5-dimethoxy-2-(thiophene-2-carbonylamino)benzoate.
| Compound Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 4,5-dimethoxy-2-(thiophene-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 4299184 |
| Molecular Formula | C30H22N2O8S |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.11 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl] 4,5-dimethoxy-2-(thiophene-2-carbonylamino)benzoate |
| SMILES | COc1cc(NC(=O)c2cccs2)c(C(=O)OCC(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)cc1OC |
| InChI | InChI=1S/C30H22N2O8S/c1-38-22-13-19(21(14-23(22)39-2)32-29(36)24-11-6-12-41-24)30(37)40-15-25(33)31-20-10-5-9-18-26(20)28(35)17-8-4-3-7-16(17)27(18)34/h3-14H,15H2,1-2H3,(H,31,33)(H,32,36) |
| InChIKey | PPENOARBGFIKJO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|