C13H20N2O2S — CID 43717500
5-(cyclopentylamino)-N,2-dimethylbenzenesulfonamide (PubChem CID 43717500) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 5-(cyclopentylamino)-N,2-dimethylbenzenesulfonamide.
| Compound Name | 5-(cyclopentylamino)-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43717500 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-(cyclopentylamino)-N,2-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(NC2CCCC2)ccc1C |
| InChI | InChI=1S/C13H20N2O2S/c1-10-7-8-12(15-11-5-3-4-6-11)9-13(10)18(16,17)14-2/h7-9,11,14-15H,3-6H2,1-2H3 |
| InChIKey | UHBQCFMMYLCGQM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |