C13H20N2O3S — CID 106821362
5-[(3-methoxycyclobutyl)amino]-N,2-dimethylbenzenesulfonamide (PubChem CID 106821362) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 5-[(3-methoxycyclobutyl)amino]-N,2-dimethylbenzenesulfonamide.
| Compound Name | 5-[(3-methoxycyclobutyl)amino]-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106821362 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 5-[(3-methoxycyclobutyl)amino]-N,2-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(NC2CC(OC)C2)ccc1C |
| InChI | InChI=1S/C13H20N2O3S/c1-9-4-5-10(8-13(9)19(16,17)14-2)15-11-6-12(7-11)18-3/h4-5,8,11-12,14-15H,6-7H2,1-3H3 |
| InChIKey | FAOACFQYQONXEM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |