C11H16N2O3S — CID 106821257
4-[(3-methoxycyclobutyl)amino]benzenesulfonamide (PubChem CID 106821257) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-[(3-methoxycyclobutyl)amino]benzenesulfonamide.
| Compound Name | 4-[(3-methoxycyclobutyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 106821257 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 4-[(3-methoxycyclobutyl)amino]benzenesulfonamide |
| SMILES | COC1CC(Nc2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C11H16N2O3S/c1-16-10-6-9(7-10)13-8-2-4-11(5-3-8)17(12,14)15/h2-5,9-10,13H,6-7H2,1H3,(H2,12,14,15) |
| InChIKey | XTPLMJJNIPPVDV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |