C15H24N2O3S — CID 106872019
4-[2-[(3-methoxycyclohexyl)amino]ethyl]benzenesulfonamide (PubChem CID 106872019) has the molecular formula C15H24N2O3S and a molecular weight of 312.43 g/mol. Its IUPAC name is 4-[2-[(3-methoxycyclohexyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(3-methoxycyclohexyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106872019 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-[2-[(3-methoxycyclohexyl)amino]ethyl]benzenesulfonamide |
| SMILES | COC1CCCC(NCCc2ccc(S(N)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C15H24N2O3S/c1-20-14-4-2-3-13(11-14)17-10-9-12-5-7-15(8-6-12)21(16,18)19/h5-8,13-14,17H,2-4,9-11H2,1H3,(H2,16,18,19) |
| InChIKey | GTJVIMXUENPQOQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |