C16H26N2O2S — CID 64760901
4-[2-[(2,3-dimethylcyclohexyl)amino]ethyl]benzenesulfonamide (PubChem CID 64760901) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 4-[2-[(2,3-dimethylcyclohexyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(2,3-dimethylcyclohexyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 64760901 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4-[2-[(2,3-dimethylcyclohexyl)amino]ethyl]benzenesulfonamide |
| SMILES | CC1CCCC(NCCc2ccc(S(N)(=O)=O)cc2)C1C |
| InChI | InChI=1S/C16H26N2O2S/c1-12-4-3-5-16(13(12)2)18-11-10-14-6-8-15(9-7-14)21(17,19)20/h6-9,12-13,16,18H,3-5,10-11H2,1-2H3,(H2,17,19,20) |
| InChIKey | LSXJGSJTVNAEPN-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |