C15H21N3O4S — CID 97065422
N-[(2R)-1-oxo-1-(pyridin-3-ylsulfonylamino)propan-2-yl]cyclohexanecarboxamide (PubChem CID 97065422) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[(2R)-1-oxo-1-(pyridin-3-ylsulfonylamino)propan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(2R)-1-oxo-1-(pyridin-3-ylsulfonylamino)propan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 97065422 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[(2R)-1-oxo-1-(pyridin-3-ylsulfonylamino)propan-2-yl]cyclohexanecarboxamide |
| SMILES | C[C@@H](NC(=O)C1CCCCC1)C(=O)NS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C15H21N3O4S/c1-11(17-15(20)12-6-3-2-4-7-12)14(19)18-23(21,22)13-8-5-9-16-10-13/h5,8-12H,2-4,6-7H2,1H3,(H,17,20)(H,18,19)/t11-/m1/s1 |
| InChIKey | VOAICGLYRXGGAN-LLVKDONJSA-N |
| XLogP | 0.97 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |