C18H24N2O5S — CID 97195810
N-[(2R)-1-[(4-acetylphenyl)sulfonylamino]-1-oxopropan-2-yl]cyclohexanecarboxamide (PubChem CID 97195810) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[(2R)-1-[(4-acetylphenyl)sulfonylamino]-1-oxopropan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(2R)-1-[(4-acetylphenyl)sulfonylamino]-1-oxopropan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 97195810 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-[(2R)-1-[(4-acetylphenyl)sulfonylamino]-1-oxopropan-2-yl]cyclohexanecarboxamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NC(=O)[C@@H](C)NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-12(19-18(23)15-6-4-3-5-7-15)17(22)20-26(24,25)16-10-8-14(9-11-16)13(2)21/h8-12,15H,3-7H2,1-2H3,(H,19,23)(H,20,22)/t12-/m1/s1 |
| InChIKey | WGJQXAGTCQMGKT-GFCCVEGCSA-N |
| XLogP | 1.78 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |