C11H17FN2O2S — CID 61124375
N-(1-amino-2-methylpropan-2-yl)-5-fluoro-2-methylbenzenesulfonamide (PubChem CID 61124375) has the molecular formula C11H17FN2O2S and a molecular weight of 260.33 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-5-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-5-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 61124375 |
| Molecular Formula | C11H17FN2O2S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-5-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)NC(C)(C)CN |
| InChI | InChI=1S/C11H17FN2O2S/c1-8-4-5-9(12)6-10(8)17(15,16)14-11(2,3)7-13/h4-6,14H,7,13H2,1-3H3 |
| InChIKey | FLNUQGKGYBCVNR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |