C11H17ClN2O2S2 — CID 63980942
4-amino-2-chloro-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide (PubChem CID 63980942) has the molecular formula C11H17ClN2O2S2 and a molecular weight of 308.86 g/mol. Its IUPAC name is 4-amino-2-chloro-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide.
| Compound Name | 4-amino-2-chloro-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63980942 |
| Molecular Formula | C11H17ClN2O2S2 |
| Molecular Weight | 308.86 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 4-amino-2-chloro-N-(2-methyl-3-methylsulfanylpropyl)benzenesulfonamide |
| SMILES | CSCC(C)CNS(=O)(=O)c1ccc(N)cc1Cl |
| InChI | InChI=1S/C11H17ClN2O2S2/c1-8(7-17-2)6-14-18(15,16)11-4-3-9(13)5-10(11)12/h3-5,8,14H,6-7,13H2,1-2H3 |
| InChIKey | RSBRDDXIZUTLRF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.86 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|