C12H19N3O3S2 — CID 81471363
3-amino-4-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]benzamide (PubChem CID 81471363) has the molecular formula C12H19N3O3S2 and a molecular weight of 317.44 g/mol. Its IUPAC name is 3-amino-4-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]benzamide.
| Compound Name | 3-amino-4-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 81471363 |
| Molecular Formula | C12H19N3O3S2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 3-amino-4-[(2-methyl-3-methylsulfanylpropyl)sulfamoyl]benzamide |
| SMILES | CSCC(C)CNS(=O)(=O)c1ccc(C(N)=O)cc1N |
| InChI | InChI=1S/C12H19N3O3S2/c1-8(7-19-2)6-15-20(17,18)11-4-3-9(12(14)16)5-10(11)13/h3-5,8,15H,6-7,13H2,1-2H3,(H2,14,16) |
| InChIKey | YKHRTYZEQCZPPW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|