C13H15N3O4S — CID 81466871
3-amino-4-[(5-methylfuran-2-yl)methylsulfamoyl]benzamide (PubChem CID 81466871) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 3-amino-4-[(5-methylfuran-2-yl)methylsulfamoyl]benzamide.
| Compound Name | 3-amino-4-[(5-methylfuran-2-yl)methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 81466871 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 3-amino-4-[(5-methylfuran-2-yl)methylsulfamoyl]benzamide |
| SMILES | Cc1ccc(CNS(=O)(=O)c2ccc(C(N)=O)cc2N)o1 |
| InChI | InChI=1S/C13H15N3O4S/c1-8-2-4-10(20-8)7-16-21(18,19)12-5-3-9(13(15)17)6-11(12)14/h2-6,16H,7,14H2,1H3,(H2,15,17) |
| InChIKey | QOKXZVREWLQKMH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 128.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|