C12H15N5O3S — CID 81466386
3-amino-4-[(1-methylpyrazol-4-yl)methylsulfamoyl]benzamide (PubChem CID 81466386) has the molecular formula C12H15N5O3S and a molecular weight of 309.35 g/mol. Its IUPAC name is 3-amino-4-[(1-methylpyrazol-4-yl)methylsulfamoyl]benzamide.
| Compound Name | 3-amino-4-[(1-methylpyrazol-4-yl)methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 81466386 |
| Molecular Formula | C12H15N5O3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-amino-4-[(1-methylpyrazol-4-yl)methylsulfamoyl]benzamide |
| SMILES | Cn1cc(CNS(=O)(=O)c2ccc(C(N)=O)cc2N)cn1 |
| InChI | InChI=1S/C12H15N5O3S/c1-17-7-8(5-15-17)6-16-21(19,20)11-3-2-9(12(14)18)4-10(11)13/h2-5,7,16H,6,13H2,1H3,(H2,14,18) |
| InChIKey | AIQFQFXSQXJITE-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 133.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|