C11H12BrClN4O2S — CID 62956906
3-amino-2-bromo-5-chloro-N-[(1-methylpyrazol-4-yl)methyl]benzenesulfonamide (PubChem CID 62956906) has the molecular formula C11H12BrClN4O2S and a molecular weight of 379.67 g/mol. Its IUPAC name is 3-amino-2-bromo-5-chloro-N-[(1-methylpyrazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-2-bromo-5-chloro-N-[(1-methylpyrazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62956906 |
| Molecular Formula | C11H12BrClN4O2S |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 377.96 |
| IUPAC Name | 3-amino-2-bromo-5-chloro-N-[(1-methylpyrazol-4-yl)methyl]benzenesulfonamide |
| SMILES | Cn1cc(CNS(=O)(=O)c2cc(Cl)cc(N)c2Br)cn1 |
| InChI | InChI=1S/C11H12BrClN4O2S/c1-17-6-7(4-15-17)5-16-20(18,19)10-3-8(13)2-9(14)11(10)12/h2-4,6,16H,5,14H2,1H3 |
| InChIKey | RUJDEZNXXHOQFV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|