C12H14ClFN4O2S — CID 106018286
3-(aminomethyl)-5-chloro-2-fluoro-N-[(1-methylpyrazol-4-yl)methyl]benzenesulfonamide (PubChem CID 106018286) has the molecular formula C12H14ClFN4O2S and a molecular weight of 332.79 g/mol. Its IUPAC name is 3-(aminomethyl)-5-chloro-2-fluoro-N-[(1-methylpyrazol-4-yl)methyl]benzenesulfonamide.
| Compound Name | 3-(aminomethyl)-5-chloro-2-fluoro-N-[(1-methylpyrazol-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106018286 |
| Molecular Formula | C12H14ClFN4O2S |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3-(aminomethyl)-5-chloro-2-fluoro-N-[(1-methylpyrazol-4-yl)methyl]benzenesulfonamide |
| SMILES | Cn1cc(CNS(=O)(=O)c2cc(Cl)cc(CN)c2F)cn1 |
| InChI | InChI=1S/C12H14ClFN4O2S/c1-18-7-8(5-16-18)6-17-21(19,20)11-3-10(13)2-9(4-15)12(11)14/h2-3,5,7,17H,4,6,15H2,1H3 |
| InChIKey | CYYWFKNUNLNBEL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |