C11H11BrClN3O2S2 — CID 62956542
3-amino-2-bromo-5-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide (PubChem CID 62956542) has the molecular formula C11H11BrClN3O2S2 and a molecular weight of 396.72 g/mol. Its IUPAC name is 3-amino-2-bromo-5-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-2-bromo-5-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62956542 |
| Molecular Formula | C11H11BrClN3O2S2 |
| Molecular Weight | 396.72 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | 3-amino-2-bromo-5-chloro-N-[(2-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ncc(CNS(=O)(=O)c2cc(Cl)cc(N)c2Br)s1 |
| InChI | InChI=1S/C11H11BrClN3O2S2/c1-6-15-4-8(19-6)5-16-20(17,18)10-3-7(13)2-9(14)11(10)12/h2-4,16H,5,14H2,1H3 |
| InChIKey | SZEBUDBECSHZJZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|