C11H12ClN3O2S2 — CID 114380309
3-amino-5-chloro-2-methyl-N-(1,3-thiazol-5-ylmethyl)benzenesulfonamide (PubChem CID 114380309) has the molecular formula C11H12ClN3O2S2 and a molecular weight of 317.82 g/mol. Its IUPAC name is 3-amino-5-chloro-2-methyl-N-(1,3-thiazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 3-amino-5-chloro-2-methyl-N-(1,3-thiazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114380309 |
| Molecular Formula | C11H12ClN3O2S2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 3-amino-5-chloro-2-methyl-N-(1,3-thiazol-5-ylmethyl)benzenesulfonamide |
| SMILES | Cc1c(N)cc(Cl)cc1S(=O)(=O)NCc1cncs1 |
| InChI | InChI=1S/C11H12ClN3O2S2/c1-7-10(13)2-8(12)3-11(7)19(16,17)15-5-9-4-14-6-18-9/h2-4,6,15H,5,13H2,1H3 |
| InChIKey | YOONMXFFUVWZLT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|