C13H21ClN2O2S — CID 114380295
3-amino-5-chloro-N-(3,3-dimethylbutyl)-2-methylbenzenesulfonamide (PubChem CID 114380295) has the molecular formula C13H21ClN2O2S and a molecular weight of 304.84 g/mol. Its IUPAC name is 3-amino-5-chloro-N-(3,3-dimethylbutyl)-2-methylbenzenesulfonamide.
| Compound Name | 3-amino-5-chloro-N-(3,3-dimethylbutyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 114380295 |
| Molecular Formula | C13H21ClN2O2S |
| Molecular Weight | 304.84 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-amino-5-chloro-N-(3,3-dimethylbutyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1c(N)cc(Cl)cc1S(=O)(=O)NCCC(C)(C)C |
| InChI | InChI=1S/C13H21ClN2O2S/c1-9-11(15)7-10(14)8-12(9)19(17,18)16-6-5-13(2,3)4/h7-8,16H,5-6,15H2,1-4H3 |
| InChIKey | XAECPPHNFDQTGG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.84 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|