C12H14N4O4S — CID 81465783
3-amino-4-[(5-methyl-1,2-oxazol-3-yl)methylsulfamoyl]benzamide (PubChem CID 81465783) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 3-amino-4-[(5-methyl-1,2-oxazol-3-yl)methylsulfamoyl]benzamide.
| Compound Name | 3-amino-4-[(5-methyl-1,2-oxazol-3-yl)methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 81465783 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 3-amino-4-[(5-methyl-1,2-oxazol-3-yl)methylsulfamoyl]benzamide |
| SMILES | Cc1cc(CNS(=O)(=O)c2ccc(C(N)=O)cc2N)no1 |
| InChI | InChI=1S/C12H14N4O4S/c1-7-4-9(16-20-7)6-15-21(18,19)11-3-2-8(12(14)17)5-10(11)13/h2-5,15H,6,13H2,1H3,(H2,14,17) |
| InChIKey | DFSOVJMOKYZEAK-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|