C12H21N3O2S2 — CID 80646449
2-amino-N-methyl-4-[(2-methyl-3-methylsulfanylpropyl)amino]benzenesulfonamide (PubChem CID 80646449) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-amino-N-methyl-4-[(2-methyl-3-methylsulfanylpropyl)amino]benzenesulfonamide.
| Compound Name | 2-amino-N-methyl-4-[(2-methyl-3-methylsulfanylpropyl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 80646449 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-amino-N-methyl-4-[(2-methyl-3-methylsulfanylpropyl)amino]benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCC(C)CSC)cc1N |
| InChI | InChI=1S/C12H21N3O2S2/c1-9(8-18-3)7-15-10-4-5-12(11(13)6-10)19(16,17)14-2/h4-6,9,14-15H,7-8,13H2,1-3H3 |
| InChIKey | OBQBFQKRPYIIMN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|