C9H8Cl2N4O2S — CID 64606709
5,6-dichloro-N-(1H-imidazol-2-ylmethyl)pyridine-3-sulfonamide (PubChem CID 64606709) has the molecular formula C9H8Cl2N4O2S and a molecular weight of 307.16 g/mol. Its IUPAC name is 5,6-dichloro-N-(1H-imidazol-2-ylmethyl)pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-(1H-imidazol-2-ylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64606709 |
| Molecular Formula | C9H8Cl2N4O2S |
| Molecular Weight | 307.16 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 5,6-dichloro-N-(1H-imidazol-2-ylmethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCc1ncc[nH]1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N4O2S/c10-7-3-6(4-14-9(7)11)18(16,17)15-5-8-12-1-2-13-8/h1-4,15H,5H2,(H,12,13) |
| InChIKey | QORIEDXDGZWITE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.16 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|