C11H12ClN3O4S2 — CID 43552240
2-chloro-N-(2-sulfamoylethyl)quinoline-6-sulfonamide (PubChem CID 43552240) has the molecular formula C11H12ClN3O4S2 and a molecular weight of 349.82 g/mol. Its IUPAC name is 2-chloro-N-(2-sulfamoylethyl)quinoline-6-sulfonamide.
| Compound Name | 2-chloro-N-(2-sulfamoylethyl)quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 43552240 |
| Molecular Formula | C11H12ClN3O4S2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 2-chloro-N-(2-sulfamoylethyl)quinoline-6-sulfonamide |
| SMILES | NS(=O)(=O)CCNS(=O)(=O)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C11H12ClN3O4S2/c12-11-4-1-8-7-9(2-3-10(8)15-11)21(18,19)14-5-6-20(13,16)17/h1-4,7,14H,5-6H2,(H2,13,16,17) |
| InChIKey | GJGRSUHGMXLPHH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|