C8H14N4O4S2 — CID 114613166
6-(aminomethyl)-N-(2-sulfamoylethyl)pyridine-3-sulfonamide (PubChem CID 114613166) has the molecular formula C8H14N4O4S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 6-(aminomethyl)-N-(2-sulfamoylethyl)pyridine-3-sulfonamide.
| Compound Name | 6-(aminomethyl)-N-(2-sulfamoylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114613166 |
| Molecular Formula | C8H14N4O4S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 6-(aminomethyl)-N-(2-sulfamoylethyl)pyridine-3-sulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)NCCS(N)(=O)=O)cn1 |
| InChI | InChI=1S/C8H14N4O4S2/c9-5-7-1-2-8(6-11-7)18(15,16)12-3-4-17(10,13)14/h1-2,6,12H,3-5,9H2,(H2,10,13,14) |
| InChIKey | KBCSWYRCLITFAV-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 145.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |