C11H19N3O3S — CID 114613742
6-(aminomethyl)-N-(2-ethoxypropyl)pyridine-3-sulfonamide (PubChem CID 114613742) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 6-(aminomethyl)-N-(2-ethoxypropyl)pyridine-3-sulfonamide.
| Compound Name | 6-(aminomethyl)-N-(2-ethoxypropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 114613742 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 6-(aminomethyl)-N-(2-ethoxypropyl)pyridine-3-sulfonamide |
| SMILES | CCOC(C)CNS(=O)(=O)c1ccc(CN)nc1 |
| InChI | InChI=1S/C11H19N3O3S/c1-3-17-9(2)7-14-18(15,16)11-5-4-10(6-12)13-8-11/h4-5,8-9,14H,3,6-7,12H2,1-2H3 |
| InChIKey | DYCUTKPJXBLCEF-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |