C16H24N2O2S — CID 106504730
3-amino-N-(cyclohex-3-en-1-ylmethyl)-2,5,6-trimethylbenzenesulfonamide (PubChem CID 106504730) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-amino-N-(cyclohex-3-en-1-ylmethyl)-2,5,6-trimethylbenzenesulfonamide.
| Compound Name | 3-amino-N-(cyclohex-3-en-1-ylmethyl)-2,5,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106504730 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-amino-N-(cyclohex-3-en-1-ylmethyl)-2,5,6-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)NCC2CC=CCC2)c1C |
| InChI | InChI=1S/C16H24N2O2S/c1-11-9-15(17)13(3)16(12(11)2)21(19,20)18-10-14-7-5-4-6-8-14/h4-5,9,14,18H,6-8,10,17H2,1-3H3 |
| InChIKey | ZTHLYNLHVGANOD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|