C14H18N2O4S — CID 102931174
4-amino-2-(cyclohex-3-en-1-ylmethylsulfamoyl)benzoic acid (PubChem CID 102931174) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-amino-2-(cyclohex-3-en-1-ylmethylsulfamoyl)benzoic acid.
| Compound Name | 4-amino-2-(cyclohex-3-en-1-ylmethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 102931174 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-amino-2-(cyclohex-3-en-1-ylmethylsulfamoyl)benzoic acid |
| SMILES | Nc1ccc(C(=O)O)c(S(=O)(=O)NCC2CC=CCC2)c1 |
| InChI | InChI=1S/C14H18N2O4S/c15-11-6-7-12(14(17)18)13(8-11)21(19,20)16-9-10-4-2-1-3-5-10/h1-2,6-8,10,16H,3-5,9,15H2,(H,17,18) |
| InChIKey | ACMYYLMAVGMCAY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|