C9H13N7O2S — CID 80646512
2-amino-N-methyl-4-(2H-tetrazol-5-ylmethylamino)benzenesulfonamide (PubChem CID 80646512) has the molecular formula C9H13N7O2S and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-amino-N-methyl-4-(2H-tetrazol-5-ylmethylamino)benzenesulfonamide.
| Compound Name | 2-amino-N-methyl-4-(2H-tetrazol-5-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 80646512 |
| Molecular Formula | C9H13N7O2S |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-amino-N-methyl-4-(2H-tetrazol-5-ylmethylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCc2nn[nH]n2)cc1N |
| InChI | InChI=1S/C9H13N7O2S/c1-11-19(17,18)8-3-2-6(4-7(8)10)12-5-9-13-15-16-14-9/h2-4,11-12H,5,10H2,1H3,(H,13,14,15,16) |
| InChIKey | UBOQWVLPFWBHLJ-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 138.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|