C11H15N5O2S — CID 80645593
2-amino-N-methyl-4-(1H-pyrazol-4-ylmethylamino)benzenesulfonamide (PubChem CID 80645593) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-amino-N-methyl-4-(1H-pyrazol-4-ylmethylamino)benzenesulfonamide.
| Compound Name | 2-amino-N-methyl-4-(1H-pyrazol-4-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 80645593 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-amino-N-methyl-4-(1H-pyrazol-4-ylmethylamino)benzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NCc2cn[nH]c2)cc1N |
| InChI | InChI=1S/C11H15N5O2S/c1-13-19(17,18)11-3-2-9(4-10(11)12)14-5-8-6-15-16-7-8/h2-4,6-7,13-14H,5,12H2,1H3,(H,15,16) |
| InChIKey | GGZBQMHXIALTOL-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|